(-)-Syringaresinol 4-O-β-D-glucopyranoside structure
|
Common Name | (-)-Syringaresinol 4-O-β-D-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 137038-13-2 | Molecular Weight | 580.578 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 778.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C28H36O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 424.6±32.9 °C | |
Use of (-)-Syringaresinol 4-O-β-D-glucopyranosideEpisyringaresinol 4'-O-β-D-glncopyranoside (compound 22), isolated from Alhagi sparsifolia Shap, is a natural potential neuroinflammatory inhibitor[1]. |
| Name | 4-[4-(4-Hydroxy-3,5-dimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2,6-dimethoxyphenyl hexopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Episyringaresinol 4'-O-β-D-glncopyranoside (compound 22), isolated from Alhagi sparsifolia Shap, is a natural potential neuroinflammatory inhibitor[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Episyringaresinol 4'-O-β-D-glncopyranoside inhibits NO production in LPS-induced N9 microglial cells dramatically in a dose independent manner with an IC50 of 91.50 μM. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 778.5±60.0 °C at 760 mmHg |
| Molecular Formula | C28H36O13 |
| Molecular Weight | 580.578 |
| Flash Point | 424.6±32.9 °C |
| Exact Mass | 580.215576 |
| LogP | -1.60 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | WEKCEGQSIIQPAQ-FKLBZQFOSA-N |
| SMILES | COc1cc(C2OCC3C(c4cc(OC)c(OC5OC(CO)C(O)C(O)C5O)c(OC)c4)OCC23)cc(OC)c1O |
| Storage condition | -20℃ |
| Hexopyranoside, 2,6-dimethoxy-4-[tetrahydro-4-(4-hydroxy-3,5-dimethoxyphenyl)-1H,3H-furo[3,4-c]furan-1-yl]phenyl |
| 4-[4-(4-Hydroxy-3,5-dimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2,6-dimethoxyphenyl hexopyranoside |
| (-)-Syringaresinol 4-O-β-D-glucopyranoside |