(4,4-dimethoxy-2,2,6,6-tetramethylpiperidin-1-yl) acetate structure
|
Common Name | (4,4-dimethoxy-2,2,6,6-tetramethylpiperidin-1-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 137063-51-5 | Molecular Weight | 259.34200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4,4-dimethoxy-2,2,6,6-tetramethylpiperidin-1-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H25NO4 |
|---|---|
| Molecular Weight | 259.34200 |
| Exact Mass | 259.17800 |
| PSA | 48.00000 |
| LogP | 2.04450 |
| InChIKey | DWHIKZDEZSJEMP-UHFFFAOYSA-N |
| SMILES | COC1(OC)CC(C)(C)N(OC(C)=O)C(C)(C)C1 |
|
~%
(4,4-dimethoxy-... CAS#:137063-51-5 |
| Literature: Alessi, Dario R.; Corrie, John E. T.; Feeney, James; Trayer, Ian P.; Trentham, David R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991 , # 9 p. 2243 - 2247 |
| Piperidine,1-(acetyloxy)-4,4-dimethoxy-2,2,6,6-tetramethyl |
| 1-acetoxy-4,4-dimethoxy-2,2,6,6-tetramethylpiperidine |