(3,4-DIMETHOXY-BENZYL)-(2-METHOXY-1-METHYL-ETHYL)-AMINE structure
|
Common Name | (3,4-DIMETHOXY-BENZYL)-(2-METHOXY-1-METHYL-ETHYL)-AMINE | ||
|---|---|---|---|---|
| CAS Number | 137071-61-5 | Molecular Weight | 239.31100 | |
| Density | 1.016g/cm3 | Boiling Point | 317.7ºC at 760 mmHg | |
| Molecular Formula | C13H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.9ºC | |
| Name | N-[(3,4-dimethoxyphenyl)methyl]-1-methoxypropan-2-amine |
|---|
| Density | 1.016g/cm3 |
|---|---|
| Boiling Point | 317.7ºC at 760 mmHg |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31100 |
| Flash Point | 134.9ºC |
| Exact Mass | 239.15200 |
| PSA | 39.72000 |
| LogP | 2.21920 |
| Vapour Pressure | 0.000379mmHg at 25°C |
| Index of Refraction | 1.492 |
| InChIKey | QNMAKJPRKQTXCB-UHFFFAOYSA-N |
| SMILES | COCC(C)NCc1ccc(OC)c(OC)c1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |