N-(1-naphthyl)-N'-(m-ethylphenyl)-N'-ethylguanidine structure
|
Common Name | N-(1-naphthyl)-N'-(m-ethylphenyl)-N'-ethylguanidine | ||
|---|---|---|---|---|
| CAS Number | 137159-93-4 | Molecular Weight | 317.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H23N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(1-naphthyl)-N'-(m-ethylphenyl)-N'-ethylguanidine |
|---|
| Molecular Formula | C21H23N3 |
|---|---|
| Molecular Weight | 317.4 |
| InChIKey | SRNKBLLOXBRIAX-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CC=C1)N(CC)C(=NC2=CC=CC3=CC=CC=C32)N |
|
Name: In vitro concentration required to inhibit specific [3H]MK-801 radioligand binding to...
Source: ChEMBL
Target: Glutamate receptor ionotropic, NMDA 3A
External Id: CHEMBL749643
|
|
Name: Tested in vitro for the concentration required to inhibit specific [3H]DTG radioligan...
Source: ChEMBL
Target: Sigma non-opioid intracellular receptor 1
External Id: CHEMBL803935
|