N,N-dimethyl-2-phenyl-ethenesulfonamide structure
|
Common Name | N,N-dimethyl-2-phenyl-ethenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 13719-45-4 | Molecular Weight | 211.28100 | |
| Density | 1.205g/cm3 | Boiling Point | 332.8ºC at 760 mmHg | |
| Molecular Formula | C10H13NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.1ºC | |
| Name | (Z)-N,N-dimethyl-2-phenylethenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 332.8ºC at 760 mmHg |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.28100 |
| Flash Point | 155.1ºC |
| Exact Mass | 211.06700 |
| PSA | 45.76000 |
| LogP | 2.62950 |
| Vapour Pressure | 0.000142mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | NFNZBXXSRCGCIR-HJWRWDBZSA-N |
| SMILES | CN(C)S(=O)(=O)C=Cc1ccccc1 |
|
~%
N,N-dimethyl-2-... CAS#:13719-45-4 |
| Literature: Zhou, Chang-Yue; Zhu, Shou-Fei; Wang, Li-Xin; Zhou, Qi-Lin Journal of the American Chemical Society, 2010 , vol. 132, # 32 p. 10955 - 10957 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N-Dimethyl-2-phenyl-2-propansulfonamid |
| N,N-Dimethyl-2-phenylethylensulfonamid |
| 4-dimethylamino-3-nitrobenzotrifluoride |