2-[(4-fluorophenyl)amino]isonicotinonitrile structure
|
Common Name | 2-[(4-fluorophenyl)amino]isonicotinonitrile | ||
|---|---|---|---|---|
| CAS Number | 137225-11-7 | Molecular Weight | 213.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8FN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-fluoroanilino)pyridine-4-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8FN3 |
|---|---|
| Molecular Weight | 213.21000 |
| Exact Mass | 213.07000 |
| PSA | 48.71000 |
| LogP | 2.90898 |
| InChIKey | BYPSOTBKPIKIBD-UHFFFAOYSA-N |
| SMILES | N#Cc1ccnc(Nc2ccc(F)cc2)c1 |
|
~%
2-[(4-fluorophe... CAS#:137225-11-7 |
| Literature: Bernardi, Rosanna; Caronna, Tullio; Morrocchi, Sergio; Vittimberga, Bruno M. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1991 , # 9 p. 1411 - 1415 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(4-fluorophenylamino)isonicotinonitrile |
| 2-[(4-fluorophenyl)amino]pyridine-4-carbonitrile |