Serine, N-carboxy-,dibenzyl ester, bis(2-chloropropyl)carbamate (ester), DL- (8CI) structure
|
Common Name | Serine, N-carboxy-,dibenzyl ester, bis(2-chloropropyl)carbamate (ester), DL- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 13723-34-7 | Molecular Weight | 525.42100 | |
| Density | 1.266g/cm3 | Boiling Point | 658.2ºC at 760 mmHg | |
| Molecular Formula | C25H30Cl2N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 351.9ºC | |
| Name | benzyl 3-[bis(2-chloropropyl)carbamoyloxy]-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 658.2ºC at 760 mmHg |
| Molecular Formula | C25H30Cl2N2O6 |
| Molecular Weight | 525.42100 |
| Flash Point | 351.9ºC |
| Exact Mass | 524.14800 |
| PSA | 94.17000 |
| LogP | 5.10890 |
| Vapour Pressure | 3.38E-17mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | AXCVOQWOFWDOBN-UHFFFAOYSA-N |
| SMILES | CC(Cl)CN(CC(C)Cl)C(=O)OCC(NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
|
~%
Serine, N-carbo... CAS#:13723-34-7 |
| Literature: Journal of the Chemical Society [Section] C: Organic, , p. 592 - 595 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| benzyl n-[(benzyloxy)carbonyl]-o-[bis(2-chloropropyl)carbamoyl]serinate |
| BENZYL 3-[BIS(2-CHLOROPROPYL)CARBAMOYLOXY]-2-PHENYLMETHOXYCARBONYLAMINO-PROPANOATE |
| N-Benzyloxycarbonyl-O-[bis-(2-chlorpropyl)-carbamoyl]-DL-serin-benzylester |