echiguanine B structure
|
Common Name | echiguanine B | ||
|---|---|---|---|---|
| CAS Number | 137319-26-7 | Molecular Weight | 250.25700 | |
| Density | 1.74g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H14N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-N-(3-aminopropyl)-4-oxo-1,7-dihydropyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.74g/cm3 |
|---|---|
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.25700 |
| Exact Mass | 250.11800 |
| PSA | 147.16000 |
| LogP | 0.52950 |
| Index of Refraction | 1.798 |
| InChIKey | VJLKKBXETQVDAL-UHFFFAOYSA-N |
| SMILES | NCCCNC(=O)c1c[nH]c2nc(N)[nH]c(=O)c12 |
|
~%
echiguanine B CAS#:137319-26-7 |
| Literature: Saito, Yoshio; Umezawa, Kazuo; Kato, Kuniki Bioorganic and Medicinal Chemistry Letters, 1997 , vol. 7, # 7 p. 861 - 864 |
|
~%
echiguanine B CAS#:137319-26-7 |
| Literature: Shih, Chuan; Hu, Ying Tetrahedron Letters, 1994 , vol. 35, # 27 p. 4677 - 4680 |
|
~%
echiguanine B CAS#:137319-26-7 |
| Literature: Shih, Chuan; Hu, Ying Tetrahedron Letters, 1994 , vol. 35, # 27 p. 4677 - 4680 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-(3-Aminopropyl)-2-amino-4-hydroxy-7H-pyrrolo(2,3-d)pyrimidine-5-carboxamide |
| Echiguanine B |
| 1H-Pyrrolo(2,3-d)pyrimidine-5-carboxamide,2-amino-N-(3-aminopropyl)-4,7-dihydro-4-oxo |