Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane
Modify Date: 2025-09-09 12:36:14
Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane structure
|
Common Name | Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane | ||
|---|---|---|---|---|
| CAS Number | 1373355-40-8 | Molecular Weight | 331.08 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H34GeN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H34GeN4 |
|---|---|
| Molecular Weight | 331.08 |
| InChIKey | XNQGCRBODMNBPY-UHFFFAOYSA-N |
| SMILES | CN(C)[Ge]1(N(C)C)N(C(C)(C)C)CCN1C(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane? |
| A: InChIKey of Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane is XNQGCRBODMNBPY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane? |
| A: Molecular formula of Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane is C14H34GeN4. |
| Q: What is the Chinese name of 1373355-40-8? |
| A: Chinese name of 1373355-40-8 is 1373355-40-8. |
| Q: What is the English name of Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane? |
| A: The English name of Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane is Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane. |
| Q: What is the CAS number of Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane? |
| A: CAS number of Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane is 1373355-40-8. |
| Q: What is the SMILES notation of Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane? |
| A: SMILES notation of Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane is CN(C)[Ge]1(N(C)C)N(C(C)(C)C)CCN1C(C)(C)C. |
| Q: What is the molecular weight of Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane? |
| A: Molecular weight of Bis(dimethylamino)(N,N'-di-t-butylethylenediamino)germane is 331.08. |