3-(2-fluorophenoxy)-7-hydroxychromen-4-one
Modify Date: 2025-08-28 11:30:40
3-(2-fluorophenoxy)-7-hydroxychromen-4-one structure
|
Common Name | 3-(2-fluorophenoxy)-7-hydroxychromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 137374-74-4 | Molecular Weight | 272.22800 | |
| Density | 1.454g/cm3 | Boiling Point | 427.7ºC at 760mmHg | |
| Molecular Formula | C15H9FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.4ºC | |
| Name | 3-(2-fluorophenoxy)-7-hydroxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.454g/cm3 |
|---|---|
| Boiling Point | 427.7ºC at 760mmHg |
| Molecular Formula | C15H9FO4 |
| Molecular Weight | 272.22800 |
| Flash Point | 212.4ºC |
| Exact Mass | 272.04800 |
| PSA | 59.67000 |
| LogP | 3.43000 |
| Vapour Pressure | 6.46E-08mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | HRRFNGSXGVNKIR-UHFFFAOYSA-N |
| SMILES | O=c1c(Oc2ccccc2F)coc2cc(O)ccc12 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4H-1-Benzopyran-4-one,3-(2-fluorophenoxy)-7-hydroxy |
| 3-(2-Fluoro-phenoxy)-7-hydroxy-chromen-4-one |
| 3-(2-fluorophenoxy)-7-hydroxy-4h-1-benzopyran-4-on |
| 3-(2-Fluorophenoxy)-7-hydroxy-4H-1-benzopyran-4-one |