HIV-1 inhibitor-47 structure
|
Common Name | HIV-1 inhibitor-47 | ||
|---|---|---|---|---|
| CAS Number | 137448-39-6 | Molecular Weight | 242.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HIV-1 inhibitor-47HIV-1 inhibitor-47 is an inhibitor of HIV-1, and inhibits vif-dependent degradation of human APOBEC3G, with an IC50 value of 14.33 μM. HIV-1 inhibitor-47 also involves in derivatives of 1-(2-pyrimidinyl)piperazine synthesis, with potential antianxiety, antidepressant, and antipsychotic effect[1][2][3]. |
| Name | 2-(4-(Pyrazin-2-yl)piperazin-1-yl)pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Description | HIV-1 inhibitor-47 is an inhibitor of HIV-1, and inhibits vif-dependent degradation of human APOBEC3G, with an IC50 value of 14.33 μM. HIV-1 inhibitor-47 also involves in derivatives of 1-(2-pyrimidinyl)piperazine synthesis, with potential antianxiety, antidepressant, and antipsychotic effect[1][2][3]. |
|---|---|
| Related Catalog | |
| Target |
HIV (Vif-dependent degradation of human APOBEC3G)[1] |
| In Vitro | APOBEC3G (A3G), a host cytidine deaminase that can block HIV-1 replication and shows antiviral activity. However HIV-1 develops the ability to hijack the cellular ubiquitin/proteasome degradation pathway[1]. HIV-1 inhibitor-47 targets APOBEC3G-apolipoprotein B mRNA editing enzyme catalytic subunit 3G (human), and works on the HIV-1 Vif-APOBEC3G interaction[2]. |
| References |
[3]. Pubchem: 2-(4-(Pyrazin-2-yl)piperazin-1-yl)pyrimidine-BioAssay Results. |
| Molecular Formula | C12H14N6 |
|---|---|
| Molecular Weight | 242.28 |
| InChIKey | ZHRRMTBJVSOJRB-UHFFFAOYSA-N |
| SMILES | c1cnc(N2CCN(c3cnccn3)CC2)nc1 |
| Storage condition | 2-8°C |
| MFCD06371724 |