1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide
Modify Date: 2025-11-05 10:32:01
1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide structure
|
Common Name | 1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1374530-89-8 | Molecular Weight | 285.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11N5OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11N5OS |
|---|---|
| Molecular Weight | 285.33 |
| InChIKey | RSIYDIWSUVMKGT-UHFFFAOYSA-N |
| SMILES | Cn1nc(-c2ccccc2)cc1C(=O)Nc1nncs1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide? |
| A: InChIKey of 1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide is RSIYDIWSUVMKGT-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide? |
| A: CAS number of 1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide is 1374530-89-8. |
| Q: What is the SMILES notation of 1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide? |
| A: SMILES notation of 1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide is Cn1nc(-c2ccccc2)cc1C(=O)Nc1nncs1. |
| Q: What is the molecular formula of 1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide? |
| A: Molecular formula of 1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide is C13H11N5OS. |
| Q: What is the English name of 1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide? |
| A: The English name of 1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide is 1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide. |
| Q: What is the molecular weight of 1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide? |
| A: Molecular weight of 1-methyl-3-phenyl-N-(1,3,4-thiadiazol-2-yl)-1H-pyrazole-5-carboxamide is 285.33. |
| Q: What is the Chinese name of 1374530-89-8? |
| A: Chinese name of 1374530-89-8 is 1374530-89-8. |