Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate
Modify Date: 2026-07-05 20:37:37
Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate structure
|
Common Name | Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1374580-75-2 | Molecular Weight | 239.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21NO2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21NO2Si |
|---|---|
| Molecular Weight | 239.39 |
| InChIKey | FSOOKKHLCZDGTC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCC(C#C[Si](C)(C)C)NC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate? |
| A: Molecular weight of Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate is 239.39. |
| Q: What is the molecular formula of Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate? |
| A: Molecular formula of Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate is C12H21NO2Si. |
| Q: What is the CAS number of Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate? |
| A: CAS number of Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate is 1374580-75-2. |
| Q: What is the SMILES notation of Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate? |
| A: SMILES notation of Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate is COC(=O)C1CCC(C#C[Si](C)(C)C)NC1. |
| Q: What is the Chinese name of 1374580-75-2? |
| A: Chinese name of 1374580-75-2 is 1374580-75-2. |
| Q: What is the InChIKey of Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate? |
| A: InChIKey of Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate is FSOOKKHLCZDGTC-UHFFFAOYSA-N. |
| Q: What is the English name of Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate? |
| A: The English name of Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate is Methyl 6-(2-trimethylsilylethynyl)piperidine-3-carboxylate. |