tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate
Modify Date: 2026-08-30 18:33:11
tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate structure
|
Common Name | tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1374655-42-1 | Molecular Weight | 227.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21NO3 |
|---|---|
| Molecular Weight | 227.30 |
| InChIKey | JIFWBGWFDJMEGF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C)(C)C1C=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate? |
| A: Molecular weight of tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate is 227.30. |
| Q: What is the molecular formula of tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate? |
| A: Molecular formula of tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate is C12H21NO3. |
| Q: What is the Chinese name of 1374655-42-1? |
| A: Chinese name of 1374655-42-1 is 1374655-42-1. |
| Q: What is the CAS number of tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate? |
| A: CAS number of tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate is 1374655-42-1. |
| Q: What is the InChIKey of tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate? |
| A: InChIKey of tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate is JIFWBGWFDJMEGF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate? |
| A: SMILES notation of tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(C)(C)C1C=O. |
| Q: What is the English name of tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate? |
| A: The English name of tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate is tert-Butyl 2-formyl-3,3-dimethylpyrrolidine-1-carboxylate. |