Ianthellamide A
Ianthellamide A structure
|
Common Name | Ianthellamide A | ||
|---|---|---|---|---|
| CAS Number | 1374875-85-0 | Molecular Weight | 490.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18Br2N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ianthellamide A |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18Br2N2O6S |
|---|---|
| Molecular Weight | 490.17 |
| InChIKey | LUKTVGRPGJKVIG-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCCOC(CN)c1cc(Br)c(OS(=O)(=O)O)c(Br)c1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Ianthellamide A? |
| A: SMILES notation of Ianthellamide A is CC(=O)NCCCOC(CN)c1cc(Br)c(OS(=O)(=O)O)c(Br)c1. |
| Q: What is the Chinese name of 1374875-85-0? |
| A: Chinese name of 1374875-85-0 is 1374875-85-0. |
| Q: What is the molecular weight of Ianthellamide A? |
| A: Molecular weight of Ianthellamide A is 490.17. |
| Q: What is the InChIKey of Ianthellamide A? |
| A: InChIKey of Ianthellamide A is LUKTVGRPGJKVIG-UHFFFAOYSA-N. |
| Q: What is the English name of Ianthellamide A? |
| A: The English name of Ianthellamide A is Ianthellamide A. |
| Q: What is the CAS number of Ianthellamide A? |
| A: CAS number of Ianthellamide A is 1374875-85-0. |
| Q: What is the molecular formula of Ianthellamide A? |
| A: Molecular formula of Ianthellamide A is C13H18Br2N2O6S. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |