Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate
Modify Date: 2025-09-10 08:40:36
![Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate Structure](https://www.chemsrc.com/extcaspic/246/1375304-03-2.png)
Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate structure
|
Common Name | Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1375304-03-2 | Molecular Weight | 212.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16N2O3 |
|---|---|
| Molecular Weight | 212.25 |
| InChIKey | UWBRCLKXPHJITK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC(=O)N2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1375304-03-2? |
| A: Chinese name of 1375304-03-2 is 1375304-03-2. |
| Q: What is the SMILES notation of Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate? |
| A: SMILES notation of Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate is CC(C)(C)OC(=O)N1CC2(CC(=O)N2)C1. |
| Q: What is the molecular weight of Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate? |
| A: Molecular weight of Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate is 212.25. |
| Q: What is the English name of Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate? |
| A: The English name of Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate is Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate. |
| Q: What is the molecular formula of Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate? |
| A: Molecular formula of Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate is C10H16N2O3. |
| Q: What is the InChIKey of Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate? |
| A: InChIKey of Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate is UWBRCLKXPHJITK-UHFFFAOYSA-N. |
| Q: What is the CAS number of Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate? |
| A: CAS number of Tert-butyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate is 1375304-03-2. |