1,2-Ethanediol,1-phenyl-, 1,2-dipropanoate structure
|
Common Name | 1,2-Ethanediol,1-phenyl-, 1,2-dipropanoate | ||
|---|---|---|---|---|
| CAS Number | 13756-18-8 | Molecular Weight | 250.29000 | |
| Density | 1.092g/cm3 | Boiling Point | 336.2ºC at 760mmHg | |
| Molecular Formula | C14H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.2ºC | |
| Name | (2-phenyl-2-propanoyloxyethyl) propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.092g/cm3 |
|---|---|
| Boiling Point | 336.2ºC at 760mmHg |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29000 |
| Flash Point | 161.2ºC |
| Exact Mass | 250.12100 |
| PSA | 52.60000 |
| LogP | 2.63410 |
| Vapour Pressure | 0.000114mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | XVAFLALVAOXSMJ-UHFFFAOYSA-N |
| SMILES | CCC(=O)OCC(OC(=O)CC)c1ccccc1 |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 1-Phenyl-1,2-diyl dipropanoate |
| (1-phenyl-2-propanoyloxy-ethyl) propanoate |