3-cyclopropyl-3-methoxy-1-(4-methoxyphenyl)azetidine-2,4-dione structure
|
Common Name | 3-cyclopropyl-3-methoxy-1-(4-methoxyphenyl)azetidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 137628-99-0 | Molecular Weight | 261.27300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-cyclopropyl-3-methoxy-1-(4-methoxyphenyl)azetidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H15NO4 |
|---|---|
| Molecular Weight | 261.27300 |
| Exact Mass | 261.10000 |
| PSA | 55.84000 |
| LogP | 1.42860 |
| InChIKey | LPDCRZCRXKIKEQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2C(=O)C(OC)(C3CC3)C2=O)cc1 |
|
~74%
3-cyclopropyl-3... CAS#:137628-99-0 |
| Literature: Alcaide, Benito; Dominguez, Gema; Plumet, Joaquin; Sierra, Miguel A. Journal of Organic Chemistry, 1992 , vol. 57, # 2 p. 447 - 451 |
|
~%
3-cyclopropyl-3... CAS#:137628-99-0 |
| Literature: Alcaide, Benito; Dominguez, Gema; Plumet, Joaquin; Sierra, Miguel A. Journal of Organic Chemistry, 1992 , vol. 57, # 2 p. 447 - 451 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Cyclopropyl-3-methoxy-1-(p-methoxyphenyl)azetidine-2,4-dione |
| 2,4-Azetidinedione,3-cyclopropyl-3-methoxy-1-(4-methoxyphenyl) |