ethyl 2-(4H-[1,2,4]triazolo[4,3-a][1,5]benzodiazepin-5-ylsulfanyl)acetate structure
|
Common Name | ethyl 2-(4H-[1,2,4]triazolo[4,3-a][1,5]benzodiazepin-5-ylsulfanyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 137731-27-2 | Molecular Weight | 302.35200 | |
| Density | 1.4g/cm3 | Boiling Point | 497.1ºC at 760 mmHg | |
| Molecular Formula | C14H14N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.4ºC | |
| Name | ethyl 2-(4H-[1,2,4]triazolo[4,3-a][1,5]benzodiazepin-5-ylsulfanyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 497.1ºC at 760 mmHg |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.35200 |
| Flash Point | 254.4ºC |
| Exact Mass | 302.08400 |
| PSA | 94.67000 |
| LogP | 1.58530 |
| Vapour Pressure | 5.1E-10mmHg at 25°C |
| Index of Refraction | 1.693 |
| InChIKey | GWQWBGWPDSIXFL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CSC1=Nc2ccccc2-n2cnnc2C1 |
|
~%
ethyl 2-(4H-[1,... CAS#:137731-27-2 |
| Literature: Roma; Grossi; Di Braccio; Ghia; Mattioli European Journal of Medicinal Chemistry, 1991 , vol. 26, # 5 p. 489 - 496 |
|
~%
ethyl 2-(4H-[1,... CAS#:137731-27-2 |
| Literature: Roma; Grossi; Di Braccio; Ghia; Mattioli European Journal of Medicinal Chemistry, 1991 , vol. 26, # 5 p. 489 - 496 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Acetic acid,(4H-(1,2,4)triazolo(4,3-a)(1,5)benzodiazepin-5-ylthio)-,ethyl ester |
| 5-(((Ethoxycarbonyl)methyl)thio)-4H-(1,2,4)triazolo(4,3-a)(1,5)benzodiazepine |