2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]acetic acid structure
|
Common Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 137780-69-9 | Molecular Weight | 446.06700 | |
| Density | 1.784g/cm3 | Boiling Point | 55ºC | |
| Molecular Formula | C8HF15O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.6ºC | |
| Name | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.784g/cm3 |
|---|---|
| Boiling Point | 55ºC |
| Molecular Formula | C8HF15O4 |
| Molecular Weight | 446.06700 |
| Flash Point | 96.6ºC |
| Exact Mass | 445.96400 |
| PSA | 55.76000 |
| LogP | 4.30830 |
| Vapour Pressure | 0.0166mmHg at 25°C |
| Index of Refraction | 1.297 |
| InChIKey | PPSAKBBLKCJDCR-UHFFFAOYSA-N |
| SMILES | O=C(O)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| RIDADR | UN 3265 |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| PC7256 |
| Perfluoro-3,6-dioxadecanoic acid |
| Acetic acid,2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy] |