1H-Indole-7-propanamide
Modify Date: 2026-07-21 09:08:42
1H-Indole-7-propanamide structure
|
Common Name | 1H-Indole-7-propanamide | ||
|---|---|---|---|---|
| CAS Number | 1378466-86-4 | Molecular Weight | 188.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H-Indole-7-propanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12N2O |
|---|---|
| Molecular Weight | 188.23 |
| InChIKey | DNPFSITYNPSQMS-UHFFFAOYSA-N |
| SMILES | NC(=O)CCc1cccc2cc[nH]c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1H-Indole-7-propanamide? |
| A: SMILES notation of 1H-Indole-7-propanamide is NC(=O)CCc1cccc2cc[nH]c12. |
| Q: What is the English name of 1H-Indole-7-propanamide? |
| A: The English name of 1H-Indole-7-propanamide is 1H-Indole-7-propanamide. |
| Q: What is the InChIKey of 1H-Indole-7-propanamide? |
| A: InChIKey of 1H-Indole-7-propanamide is DNPFSITYNPSQMS-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1378466-86-4? |
| A: Chinese name of 1378466-86-4 is 1378466-86-4. |
| Q: What is the CAS number of 1H-Indole-7-propanamide? |
| A: CAS number of 1H-Indole-7-propanamide is 1378466-86-4. |
| Q: What is the molecular weight of 1H-Indole-7-propanamide? |
| A: Molecular weight of 1H-Indole-7-propanamide is 188.23. |
| Q: What is the molecular formula of 1H-Indole-7-propanamide? |
| A: Molecular formula of 1H-Indole-7-propanamide is C11H12N2O. |