trimethyl-[4-(4-methylphenyl)sulfonylbut-1-ynyl]silane structure
|
Common Name | trimethyl-[4-(4-methylphenyl)sulfonylbut-1-ynyl]silane | ||
|---|---|---|---|---|
| CAS Number | 137917-97-6 | Molecular Weight | 280.45800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20O2SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl-[4-(4-methylphenyl)sulfonylbut-1-ynyl]silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20O2SSi |
|---|---|
| Molecular Weight | 280.45800 |
| Exact Mass | 280.09500 |
| PSA | 42.52000 |
| LogP | 4.12040 |
| InChIKey | IDSZLYSMIWWCHZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)CCC#C[Si](C)(C)C)cc1 |
|
~63%
trimethyl-[4-(4... CAS#:137917-97-6 |
| Literature: Wenkert, Ernest; Bookser, Brett C.; Arrbenius, Thomas S. Journal of the American Chemical Society, 1992 , vol. 114, # 2 p. 644 - 654 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Silane,trimethyl[4-[(4-methylphenyl)sulfonyl]-1-butynyl] |
| 4-(p-tolysulfonyl)-1-(trimethylsilyl)-1-butyne |