2,4-Dichloro-6-nitropyridine structure
|
Common Name | 2,4-Dichloro-6-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 1379337-73-1 | Molecular Weight | 192.988 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 291.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C5H2Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.0±25.9 °C | |
| Name | 2,4-Dichloro-6-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 291.4±35.0 °C at 760 mmHg |
| Molecular Formula | C5H2Cl2N2O2 |
| Molecular Weight | 192.988 |
| Flash Point | 130.0±25.9 °C |
| Exact Mass | 191.949326 |
| PSA | 58.71000 |
| LogP | 1.84 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | RHPOXXQUAPLUIU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)cc(Cl)n1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-Dichloro-6-nitropyridine |
| Pyridine, 2,4-dichloro-6-nitro- |
| qc-6601 |