1-(2,4-dihydroxyphenyl)-2-(3-methoxyphenoxy)ethanone structure
|
Common Name | 1-(2,4-dihydroxyphenyl)-2-(3-methoxyphenoxy)ethanone | ||
|---|---|---|---|---|
| CAS Number | 137987-87-2 | Molecular Weight | 274.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,4-dihydroxyphenyl)-2-(3-methoxyphenoxy)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O5 |
|---|---|
| Molecular Weight | 274.26900 |
| Exact Mass | 274.08400 |
| PSA | 75.99000 |
| LogP | 2.36810 |
| Vapour Pressure | 6.89E-11mmHg at 25°C |
| InChIKey | ZCHQGGGXYNOBNW-UHFFFAOYSA-N |
| SMILES | COc1cccc(OCC(=O)c2ccc(O)cc2O)c1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
|
Name: Inhibition of human KLF10 expressed in human HeLa cells assessed as reduction in tran...
Source: ChEMBL
Target: Krueppel-like factor 10
External Id: CHEMBL3411252
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
| F3139-1212 |
| Ethanone,1-(2,4-dihydroxyphenyl)-2-(3-methoxyphenoxy) |