tris[(4-methylphenyl)sulfanyl]-sulfanylidene-phosphorane structure
|
Common Name | tris[(4-methylphenyl)sulfanyl]-sulfanylidene-phosphorane | ||
|---|---|---|---|---|
| CAS Number | 13799-88-7 | Molecular Weight | 432.62500 | |
| Density | 1.29g/cm3 | Boiling Point | 577.8ºC at 760 mmHg | |
| Molecular Formula | C21H21PS4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 303.2ºC | |
| Name | tris[(4-methylphenyl)sulfanyl]-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 577.8ºC at 760 mmHg |
| Molecular Formula | C21H21PS4 |
| Molecular Weight | 432.62500 |
| Flash Point | 303.2ºC |
| Exact Mass | 432.02600 |
| PSA | 117.80000 |
| LogP | 9.16360 |
| Vapour Pressure | 9.58E-13mmHg at 25°C |
| Index of Refraction | 1.693 |
| InChIKey | BWOSQIJRMQNKMD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(SP(=S)(Sc2ccc(C)cc2)Sc2ccc(C)cc2)cc1 |
| HS Code | 2931900090 |
|---|
|
~%
tris[(4-methylp... CAS#:13799-88-7 |
| Literature: Rosnati Gazzetta Chimica Italiana, 1946 , vol. 76, p. 272,277 |
| Precursor 1 | |
|---|---|
| DownStream 3 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Tetrathiophosphorsaeure-tri-p-tolylester |
| Tri-p-tolyl-tetrathiophosphat |
| tetrathiophosphoric acid tri-p-tolyl ester |