2,3-diphosphonooxypropanoic acid structure
|
Common Name | 2,3-diphosphonooxypropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 138-81-8 | Molecular Weight | 266.03700 | |
| Density | 2.143g/cm3 | Boiling Point | 669.8ºC at 760mmHg | |
| Molecular Formula | C3H8O10P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 358.9ºC | |
Use of 2,3-diphosphonooxypropanoic acid2,3-Diphosphoglyceric acid (2,3-DPG) is an intermediate of the glycolytic pathway. 2,3-Diphosphoglyceric acid stabilizes the deoxygenated form of hemoglobin by allosteric binding and facilitates oxygen release at tissue sites. 2,3-Diphosphoglyceric acid binds to hemoglobin and decrease its affinity for oxygen[1][2]. |
| Name | 2,3-bisphosphoglyceric acid |
|---|---|
| Synonym | More Synonyms |
| Description | 2,3-Diphosphoglyceric acid (2,3-DPG) is an intermediate of the glycolytic pathway. 2,3-Diphosphoglyceric acid stabilizes the deoxygenated form of hemoglobin by allosteric binding and facilitates oxygen release at tissue sites. 2,3-Diphosphoglyceric acid binds to hemoglobin and decrease its affinity for oxygen[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.143g/cm3 |
|---|---|
| Boiling Point | 669.8ºC at 760mmHg |
| Molecular Formula | C3H8O10P2 |
| Molecular Weight | 266.03700 |
| Flash Point | 358.9ºC |
| Exact Mass | 265.95900 |
| PSA | 190.44000 |
| InChIKey | XOHUEYCVLUUEJJ-UHFFFAOYSA-N |
| SMILES | O=C(O)C(COP(=O)(O)O)OP(=O)(O)O |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 2,3-Diphospho-D-glyceric acid |
| 2,3-bis-phosphonooxy-propionic acid |
| 2,3-Diphosphoglycerate |
| 2,3-Dpg |
| 2,3-diphosphonooxypropanoic acid |
| di-phospho-glycerate |
| D-glyceric acid bisphosphate |
| 2,3-Bisphosphoglycerate |
| 2,3-Bis-phosphonooxy-propionsaeure |
| Glycerinsaeure-2,3-diphosphat |
| Diphoshate glyceric acid |
| 2,3-Diphosphoglyceric acid |