Ethanone,2-hydroxy-1,2-diphenyl-, 2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | Ethanone,2-hydroxy-1,2-diphenyl-, 2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 13804-47-2 | Molecular Weight | 392.36500 | |
| Density | 1.37g/cm3 | Boiling Point | 585.1ºC at 760 mmHg | |
| Molecular Formula | C20H16N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 307.6ºC | |
| Name | (2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]-1,2-diphenylethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 585.1ºC at 760 mmHg |
| Molecular Formula | C20H16N4O5 |
| Molecular Weight | 392.36500 |
| Flash Point | 307.6ºC |
| Exact Mass | 392.11200 |
| PSA | 136.26000 |
| LogP | 5.17220 |
| Vapour Pressure | 1.57E-14mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | QVKWDKPHEMCSMJ-ZBJSNUHESA-N |
| SMILES | O=[N+]([O-])c1ccc(NN=C(c2ccccc2)C(O)c2ccccc2)c([N+](=O)[O-])c1 |
| HS Code | 2928000090 |
|---|
|
~%
Ethanone,2-hydr... CAS#:13804-47-2 |
| Literature: Kurihara; Hoshi Bulletin of the Chemical Society of Japan, 1970 , vol. 43, p. 546 |
|
~%
Ethanone,2-hydr... CAS#:13804-47-2 |
| Literature: Campbell Analyst (Cambridge, United Kingdom), 1936 , vol. 61, p. 391,393 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Benzoin-2,4-dinitrophenylhydrazon |