7-methoxy-1-naphthaleneacetamide structure
|
Common Name | 7-methoxy-1-naphthaleneacetamide | ||
|---|---|---|---|---|
| CAS Number | 138113-07-2 | Molecular Weight | 215.248 | |
| Density | 1.188 | Boiling Point | 452.7±28.0 °C at 760 mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | 200 °C | |
| MSDS | N/A | Flash Point | 249.1±20.3 °C | |
| Name | 2-(7-methoxynaphthalen-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188 |
|---|---|
| Boiling Point | 452.7±28.0 °C at 760 mmHg |
| Melting Point | 200 °C |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.248 |
| Flash Point | 249.1±20.3 °C |
| Exact Mass | 215.094635 |
| PSA | 53.31000 |
| LogP | 1.60 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | LGYBVRIYYBHYCX-UHFFFAOYSA-N |
| SMILES | COc1ccc2cccc(CC(N)=O)c2c1 |
| HS Code | 2924299090 |
|---|
|
~98%
7-methoxy-1-nap... CAS#:138113-07-2 |
| Literature: ALEMBIC PHARMACEUTICALS LIMITED; JAYARAMAN, Venkat, Raman; PANCHASARA, Dineshkumar, Ramabhai; PATEL, Ilesh; PRAJAPATI, Bhavesh; PATEL, Ketan; PATWA, Mitul; SHAH, Ankit Patent: WO2014/1939 A1, 2014 ; Location in patent: Page/Page column 16 ; |
|
~%
7-methoxy-1-nap... CAS#:138113-07-2 |
| Literature: Archiv der Pharmazie, , vol. 326, # 2 p. 119 - 120 |
|
~%
7-methoxy-1-nap... CAS#:138113-07-2 |
| Literature: EP2474522 A1, ; |
|
~%
7-methoxy-1-nap... CAS#:138113-07-2 |
| Literature: EP2474522 A1, ; |
|
~%
7-methoxy-1-nap... CAS#:138113-07-2 |
| Literature: EP2474522 A1, ; |
|
~%
7-methoxy-1-nap... CAS#:138113-07-2 |
| Literature: WO2014/1939 A1, ; |
|
~%
7-methoxy-1-nap... CAS#:138113-07-2 |
| Literature: WO2014/1939 A1, ; |
| Precursor 7 | |
|---|---|
| DownStream 8 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (7-Methoxy-[1]naphthyl)-essigsaeure-amid |
| (7-methoxy-[1]naphthyl)-acetic acid amide |
| (7-Methoxy-1-naphthyl)acetamide |
| 2-(7-Methoxy-1-naphthyl)acetamide |
| 1-Naphthaleneacetamide,7-methoxy |
| 1-Naphthaleneacetamide, 7-methoxy- |
| 2-(7-methoxy-1-naphthyl) acetic acid |
| 7-methoxy-1-naphthaleneacetamide |
| L66J B1VQ IO1 |
| 2-(7-methoxynaphthalen-1-yl) acetamide |
| Agomelatine Impurity 8 |
| Agomelatine Impurity B |