Tricos-1-ene-4,6,8,10,12,14,16,18-octol
Modify Date: 2026-07-23 18:17:24
Tricos-1-ene-4,6,8,10,12,14,16,18-octol structure
|
Common Name | Tricos-1-ene-4,6,8,10,12,14,16,18-octol | ||
|---|---|---|---|---|
| CAS Number | 1382486-31-8 | Molecular Weight | 450.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H46O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tricos-1-ene-4,6,8,10,12,14,16,18-octol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H46O8 |
|---|---|
| Molecular Weight | 450.6 |
| InChIKey | IUTFGBVYVKPDCH-UHFFFAOYSA-N |
| SMILES | C=CCC(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)CCCCC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Tricos-1-ene-4,6,8,10,12,14,16,18-octol? |
| A: InChIKey of Tricos-1-ene-4,6,8,10,12,14,16,18-octol is IUTFGBVYVKPDCH-UHFFFAOYSA-N. |
| Q: What is the English name of Tricos-1-ene-4,6,8,10,12,14,16,18-octol? |
| A: The English name of Tricos-1-ene-4,6,8,10,12,14,16,18-octol is Tricos-1-ene-4,6,8,10,12,14,16,18-octol. |
| Q: What is the CAS number of Tricos-1-ene-4,6,8,10,12,14,16,18-octol? |
| A: CAS number of Tricos-1-ene-4,6,8,10,12,14,16,18-octol is 1382486-31-8. |
| Q: What is the molecular formula of Tricos-1-ene-4,6,8,10,12,14,16,18-octol? |
| A: Molecular formula of Tricos-1-ene-4,6,8,10,12,14,16,18-octol is C23H46O8. |
| Q: What is the SMILES notation of Tricos-1-ene-4,6,8,10,12,14,16,18-octol? |
| A: SMILES notation of Tricos-1-ene-4,6,8,10,12,14,16,18-octol is C=CCC(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)CCCCC. |
| Q: What is the molecular weight of Tricos-1-ene-4,6,8,10,12,14,16,18-octol? |
| A: Molecular weight of Tricos-1-ene-4,6,8,10,12,14,16,18-octol is 450.6. |
| Q: What is the Chinese name of 1382486-31-8? |
| A: Chinese name of 1382486-31-8 is 1382486-31-8. |