Phenyl(trimethylsilylethynyl) ketone structure
|
Common Name | Phenyl(trimethylsilylethynyl) ketone | ||
|---|---|---|---|---|
| CAS Number | 13829-77-1 | Molecular Weight | 202.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-phenyl-3-trimethylsilylprop-2-yn-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14OSi |
|---|---|
| Molecular Weight | 202.32400 |
| Exact Mass | 202.08100 |
| PSA | 17.07000 |
| LogP | 2.75010 |
| InChIKey | FTVHYHWNGOWKAD-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC(=O)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1-phenyl-3-(trimethylsilyl)prop-2-yn-1-one |
| 1-phenyl-3-trimethylsilylpropynone |
| 1-phenyl-3-(trimethylsilyl)-2-propyn-1-one |
| 3-Trimethylsilyl-1-phenyl-2-propyn-1-one |
| 2-Propyn-1-one,1-phenyl-3-(trimethylsilyl) |
| 1-phenyl-3-(trimethylsilyl)propyn-1-one |