1-PHENYL-1H-PYRIDO[2,3-D][1,3]OXAZINE-2,4-DIONE structure
|
Common Name | 1-PHENYL-1H-PYRIDO[2,3-D][1,3]OXAZINE-2,4-DIONE | ||
|---|---|---|---|---|
| CAS Number | 138305-19-8 | Molecular Weight | 240.21400 | |
| Density | N/A | Boiling Point | 419.343ºC at 760 mmHg | |
| Molecular Formula | C13H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.412ºC | |
| Name | 1-phenylpyrido[2,3-d][1,3]oxazine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 419.343ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H8N2O3 |
| Molecular Weight | 240.21400 |
| Flash Point | 207.412ºC |
| Exact Mass | 240.05300 |
| PSA | 65.10000 |
| LogP | 1.33890 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | DYAATSZZCAOJLG-UHFFFAOYSA-N |
| SMILES | O=c1oc(=O)n(-c2ccccc2)c2ncccc12 |
| HS Code | 2934999090 |
|---|
|
~10%
1-PHENYL-1H-PYR... CAS#:138305-19-8 |
| Literature: Hayashi; Miwa; Ichikawa; Yoda; Miki; Ishii; Kono; Yasuzawa; Suzuki Journal of medicinal chemistry, 1993 , vol. 36, # 5 p. 617 - 626 |
|
~89%
Detail
|
| Literature: Kyowa Hakko Kogyo Co., Ltd. Patent: US5364859 A1, 1994 ; |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,4-dioxo-1-phenyl-1,4-dihydro-2H-pyrid<2,3-d>oxazine |
| 1-phenyl-2H-pyrido<2,3-d><1,3>oxazine-2,4(1H)-dione |
| 1-Phenyl-1H-pyrido[2,3-d][1,3]oxazine-2,4-dione |
| N-phenyl-3-azaisatoic anhydride |