(2S,3R,4S,5S,6R)-6-(azidomethyl)oxane-2,3,4,5-tetrol structure
|
Common Name | (2S,3R,4S,5S,6R)-6-(azidomethyl)oxane-2,3,4,5-tetrol | ||
|---|---|---|---|---|
| CAS Number | 138331-98-3 | Molecular Weight | 205.16900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H11N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S,3R,4S,5S,6R)-6-(azidomethyl)oxane-2,3,4,5-tetrol |
|---|
| Molecular Formula | C6H11N3O5 |
|---|---|
| Molecular Weight | 205.16900 |
| Exact Mass | 205.07000 |
| PSA | 139.90000 |
| InChIKey | CMLRUUHRGSJVMD-DVKNGEFBSA-N |
| SMILES | [N-]=[N+]=NCC1OC(O)C(O)C(O)C1O |
|
~%
(2S,3R,4S,5S,6R... CAS#:138331-98-3 |
| Literature: Ramirez, Johnny; Yu, Libing; Li, Jun; Braunschweiger, Paul G.; Wang, Peng George Bioorganic and Medicinal Chemistry Letters, 1996 , vol. 6, # 21 p. 2575 - 2580 |
|
~%
(2S,3R,4S,5S,6R... CAS#:138331-98-3 |
| Literature: Ramirez, Johnny; Yu, Libing; Li, Jun; Braunschweiger, Paul G.; Wang, Peng George Bioorganic and Medicinal Chemistry Letters, 1996 , vol. 6, # 21 p. 2575 - 2580 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |