4-CARBOXY-3-FLUOROPHENYLBORONICACID structure
|
Common Name | 4-CARBOXY-3-FLUOROPHENYLBORONICACID | ||
|---|---|---|---|---|
| CAS Number | 138343-92-7 | Molecular Weight | 269.26900 | |
| Density | 1.281g/cm3 | Boiling Point | 347.8ºC at 760 mmHg | |
| Molecular Formula | C13H16FNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.1ºC | |
| Name | 2-[3-amino-6-fluoro-2-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 347.8ºC at 760 mmHg |
| Molecular Formula | C13H16FNO4 |
| Molecular Weight | 269.26900 |
| Flash Point | 164.1ºC |
| Exact Mass | 269.10600 |
| PSA | 75.63000 |
| LogP | 2.87280 |
| Vapour Pressure | 1.98E-05mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | YDMOOFXQMAAXHB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(F)c1CC(=O)O |
| HS Code | 2924299090 |
|---|
|
~%
4-CARBOXY-3-FLU... CAS#:138343-92-7 |
| Literature: Clark; Muchowski; Fisher; Flippin; Repke; Souchet Synthesis, 1991 , # 10 p. 871 - 878 |
|
~%
4-CARBOXY-3-FLU... CAS#:138343-92-7 |
| Literature: Clark; Muchowski; Fisher; Flippin; Repke; Souchet Synthesis, 1991 , # 10 p. 871 - 878 |
|
~%
4-CARBOXY-3-FLU... CAS#:138343-92-7 |
| Literature: Clark; Muchowski; Fisher; Flippin; Repke; Souchet Synthesis, 1991 , # 10 p. 871 - 878 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2-boc-amino-6-fluorophenyl)acetic acid |