6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one
Modify Date: 2025-12-27 17:29:18
![6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one Structure](https://www.chemsrc.com/extcaspic/213/1383985-54-3.png)
6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one structure
|
Common Name | 6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one | ||
|---|---|---|---|---|
| CAS Number | 1383985-54-3 | Molecular Weight | 329.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15BrF2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H15BrF2O |
|---|---|
| Molecular Weight | 329.18 |
| InChIKey | HZOBUVDFWVHGEX-UHFFFAOYSA-N |
| SMILES | O=C1c2cc(Br)ccc2CC12CCC(C(F)F)CC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one? |
| A: Molecular weight of 6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one is 329.18. |
| Q: What is the CAS number of 6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one? |
| A: CAS number of 6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one is 1383985-54-3. |
| Q: What is the Chinese name of 1383985-54-3? |
| A: Chinese name of 1383985-54-3 is 1383985-54-3. |
| Q: What is the SMILES notation of 6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one? |
| A: SMILES notation of 6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one is O=C1c2cc(Br)ccc2CC12CCC(C(F)F)CC2. |
| Q: What is the molecular formula of 6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one? |
| A: Molecular formula of 6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one is C15H15BrF2O. |
| Q: What is the InChIKey of 6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one? |
| A: InChIKey of 6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one is HZOBUVDFWVHGEX-UHFFFAOYSA-N. |
| Q: What is the English name of 6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one? |
| A: The English name of 6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one is 6'-Bromo-4-(difluoromethyl)spiro[cyclohexane-1,2'-inden]-1'(3'H)-one. |