3-(dimethylamino)-1-(4-fluoro-2-hydroxyphenyl)prop-2-en-1-one structure
|
Common Name | 3-(dimethylamino)-1-(4-fluoro-2-hydroxyphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 138469-95-1 | Molecular Weight | 209.21700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(dimethylamino)-1-(4-fluoro-2-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12FNO2 |
|---|---|
| Molecular Weight | 209.21700 |
| Exact Mass | 209.08500 |
| PSA | 40.54000 |
| LogP | 1.78930 |
| InChIKey | KSHPNEYOOPCWGC-AATRIKPKSA-N |
| SMILES | CN(C)C=CC(=O)c1ccc(F)cc1O |
|
~78%
3-(dimethylamin... CAS#:138469-95-1 |
| Literature: Lowe; Elz; Reiser; Schott Archiv der Pharmazie, 1994 , vol. 327, # 4 p. 267 - 269 |
|
~%
3-(dimethylamin... CAS#:138469-95-1 |
| Literature: Xu, Runsheng; Wan, Jie-Ping; Mao, Hui; Pan, Yuanjiang Journal of the American Chemical Society, 2010 , vol. 132, # 44 p. 15531 - 15533 |
| 3-dimethylamino-1-(4-fluoro-2-hydroxyphenyl)propenone |
| 2-Propen-1-one,3-(dimethylamino)-1-(4-fluoro-2-hydroxyphenyl) |
| 1-(4-Fluor-2-hydroxyphenyl)-3-dimethylamino-2-propen-1-on |