2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate
Modify Date: 2026-07-06 20:12:24
2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate structure
|
Common Name | 2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate | ||
|---|---|---|---|---|
| CAS Number | 1385602-86-7 | Molecular Weight | 343.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H17NO4S |
|---|---|
| Molecular Weight | 343.4 |
| InChIKey | WGNIUORMHIWOHY-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)Oc2cccc3ccc(C)nc23)cc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate? |
| A: Molecular formula of 2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate is C18H17NO4S. |
| Q: What is the InChIKey of 2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate? |
| A: InChIKey of 2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate is WGNIUORMHIWOHY-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1385602-86-7? |
| A: Chinese name of 1385602-86-7 is COc1ccc(S(=O)(=O)Oc2cccc3ccc(C)nc23)cc1C. |
| Q: What is the English name of 2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate? |
| A: The English name of 2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate is 2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate. |
| Q: What is the molecular weight of 2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate? |
| A: Molecular weight of 2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate is 343.4. |
| Q: What is the SMILES notation of 2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate? |
| A: SMILES notation of 2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate is COc1ccc(S(=O)(=O)Oc2cccc3ccc(C)nc23)cc1C. |
| Q: What is the CAS number of 2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate? |
| A: CAS number of 2-Methylquinolin-8-yl 4-methoxy-3-methylbenzene-1-sulfonate is 1385602-86-7. |