4-(3-pyren-1-ylpropyl)-1,2,4-triazolidine-3,5-dione structure
|
Common Name | 4-(3-pyren-1-ylpropyl)-1,2,4-triazolidine-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 138615-27-7 | Molecular Weight | 343.37900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-pyren-1-ylpropyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H17N3O2 |
|---|---|
| Molecular Weight | 343.37900 |
| Exact Mass | 343.13200 |
| PSA | 71.17000 |
| LogP | 4.21950 |
| InChIKey | SXOXPHPVNRWMGR-UHFFFAOYSA-N |
| SMILES | O=c1[nH][nH]c(=O)n1CCCc1ccc2ccc3cccc4ccc1c2c34 |
|
~74%
4-(3-pyren-1-yl... CAS#:138615-27-7 |
| Literature: Journal of the Chemical Society - Perkin Transactions 1, , # 2 p. 167 - 174 |
|
~%
4-(3-pyren-1-yl... CAS#:138615-27-7 |
| Literature: Journal of the Chemical Society - Perkin Transactions 1, , # 2 p. 167 - 174 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,2,4-Triazolidine-3,5-dione,4-[3-(1-pyrenyl)propyl] |