2-chloro-1-(2-chloro-4-nitro-phenoxy)-4-nitro-benzene structure
|
Common Name | 2-chloro-1-(2-chloro-4-nitro-phenoxy)-4-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 13867-27-1 | Molecular Weight | 329.09200 | |
| Density | 1.585g/cm3 | Boiling Point | 386.8ºC at 760mmHg | |
| Molecular Formula | C12H6Cl2N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.7ºC | |
| Name | 2-chloro-1-(2-chloro-4-nitrophenoxy)-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.585g/cm3 |
|---|---|
| Boiling Point | 386.8ºC at 760mmHg |
| Molecular Formula | C12H6Cl2N2O5 |
| Molecular Weight | 329.09200 |
| Flash Point | 187.7ºC |
| Exact Mass | 327.96500 |
| PSA | 100.87000 |
| LogP | 5.64850 |
| Vapour Pressure | 7.68E-06mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | ZHZNXNICTMMFEC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc([N+](=O)[O-])cc2Cl)c(Cl)c1 |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,2'-Dichlor-4,4'-dinitro-diphenylether |
| 2-CHLORO-1-(2-CHLORO-4-NITRO-PHENOXY)-4-NITRO-BENZENE |
| 2,2'-Dinchlor-4,4'-dinitro-diphenylaether |
| Ether,bis(2-chloro-4-nitrophenyl) |
| Bis(2-chloro-4-nitrophenyl) ether |