1,4,5,8-tetramethyl-3,4-dihydro-2H-naphthalen-1-ol structure
|
Common Name | 1,4,5,8-tetramethyl-3,4-dihydro-2H-naphthalen-1-ol | ||
|---|---|---|---|---|
| CAS Number | 138722-93-7 | Molecular Weight | 204.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4,5,8-tetramethyl-3,4-dihydro-2H-naphthalen-1-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20O |
|---|---|
| Molecular Weight | 204.30800 |
| Exact Mass | 204.15100 |
| PSA | 20.23000 |
| LogP | 3.40820 |
| InChIKey | PMSPTZWCYUHMAW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c2c1C(C)CCC2(C)O |
|
~%
1,4,5,8-tetrame... CAS#:138722-93-7 |
| Literature: Mosby Journal of the American Chemical Society, 1952 , vol. 74, p. 2564,2569 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-Naphthalenol,1,2,3,4-tetrahydro-1,4,5,8-tetramethyl |
| 1,4,5,8-Tetramethyl-1,2,3,4-tetrahydro-[1]naphthol |
| 1,4,5,8-tetramethyl-1-tetralol |