(1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester
(1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester structure
|
Common Name | (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester | ||
|---|---|---|---|---|
| CAS Number | 138736-91-1 | Molecular Weight | 480.67700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H48O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H48O6 |
|---|---|
| Molecular Weight | 480.67700 |
| Exact Mass | 480.34500 |
| PSA | 71.06000 |
| LogP | 5.61960 |
| InChIKey | DGWBEODODXRBHL-OBLMWKTISA-N |
| SMILES | COC1(OC)CC(C(=O)OC2CC(C)CCC2C(C)C)C1C(=O)OC1CC(C)CCC1C(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:922-69-0
CAS#:34675-24-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2S)-3,3-dimethoxycyclobutane-1,2-dicarboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester have? |
| A: English synonyms of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester: bis[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2S)-3,3-dimethoxycyclobutane-1,2-dicarboxylate. |
| Q: What is the polar surface area (PSA) of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester? |
| A: Polar surface area (PSA) of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester is 71.06000. |
| Q: What is the LogP of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester? |
| A: LogP of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester is 5.61960. |
| Q: What is the molecular weight of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester? |
| A: Molecular weight of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester is 480.67700. |
| Q: What is the molecular formula of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester? |
| A: Molecular formula of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester is C28H48O6. |
| Q: What is the CAS number of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester? |
| A: CAS number of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester is 138736-91-1. |
| Q: What are the upstream materials of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester? |
| A: Related upstream materials(CAS) of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester: 922-69-0;34675-24-6. |
| Q: What is the Chinese name of 138736-91-1? |
| A: Chinese name of 138736-91-1 is 138736-91-1. |
| Q: What is the InChIKey of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester? |
| A: InChIKey of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester is DGWBEODODXRBHL-OBLMWKTISA-N. |
| Q: What is the SMILES notation of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester? |
| A: SMILES notation of (1S,2R)-3,3-Dimethoxy-1,2-cyclobutanedicarboxylic Acid Di-L-Menthyl Ester is COC1(OC)CC(C(=O)OC2CC(C)CCC2C(C)C)C1C(=O)OC1CC(C)CCC1C(C)C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |