trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane
![trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane Structure](https://image.chemsrc.com/caspic/127/138761-45-2.png)
trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane structure
|
Common Name | trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane | ||
|---|---|---|---|---|
| CAS Number | 138761-45-2 | Molecular Weight | 237.48900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H23NSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H23NSi2 |
|---|---|
| Molecular Weight | 237.48900 |
| Exact Mass | 237.13700 |
| PSA | 12.89000 |
| LogP | 4.01550 |
| InChIKey | POPCRORJDHTLJJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(c1ccncc1)[Si](C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~20%
trimethyl-[pyri... CAS#:138761-45-2 |
| Literature: Happer, Alan; N.G, Janice; Pool, Brett; White, Jonathan Journal of Organometallic Chemistry, 2002 , vol. 659, # 1-2 p. 10 - 14 |
|
~%
trimethyl-[pyri... CAS#:138761-45-2 |
| Literature: Anders; Opitz; Bauer Synthesis, 1991 , # 12 p. 1221 - 1227 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-bis(trimethylsilyl)methylpyridine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane? |
| A: Molecular weight of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane is 237.48900. |
| Q: What is the molecular formula of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane? |
| A: Molecular formula of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane is C12H23NSi2. |
| Q: What is the polar surface area (PSA) of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane? |
| A: Polar surface area (PSA) of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane is 12.89000. |
| Q: What is the SMILES notation of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane? |
| A: SMILES notation of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane is C[Si](C)(C)C(c1ccncc1)[Si](C)(C)C. |
| Q: What English synonyms does trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane have? |
| A: English synonyms of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane: 4-bis(trimethylsilyl)methylpyridine. |
| Q: What is the InChIKey of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane? |
| A: InChIKey of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane is POPCRORJDHTLJJ-UHFFFAOYSA-N. |
| Q: What are the upstream materials of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane? |
| A: Related upstream materials(CAS) of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane: 108-89-4;75-77-4;6844-47-9. |
| Q: What is the CAS number of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane? |
| A: CAS number of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane is 138761-45-2. |
| Q: What is the LogP of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane? |
| A: LogP of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane is 4.01550. |
| Q: What is the English name of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane? |
| A: The English name of trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane is trimethyl-[pyridin-4-yl(trimethylsilyl)methyl]silane. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |