methyl 2-(benzenesulfinyl)-5-phenylpent-2-enoate structure
|
Common Name | methyl 2-(benzenesulfinyl)-5-phenylpent-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 138770-95-3 | Molecular Weight | 314.39900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-(benzenesulfinyl)-5-phenylpent-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H18O3S |
|---|---|
| Molecular Weight | 314.39900 |
| Exact Mass | 314.09800 |
| PSA | 62.58000 |
| LogP | 4.34960 |
| InChIKey | JOVOLQBHASRHNZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=CCCc1ccccc1)S(=O)c1ccccc1 |
|
~%
methyl 2-(benze... CAS#:138770-95-3 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , # 11 p. 2683 - 2686 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| methyl (E)-5-phenyl-2-(phenylsulphinyl)pent-2-enoate |
| 2-Pentenoic acid,5-phenyl-2-(phenylsulfinyl)-,methyl ester,(E) |