(R)-4-((Benzyloxy)carbonyl)-1-(tert-butoxycarbonyl)piperazine-2-carboxylic acid structure
|
Common Name | (R)-4-((Benzyloxy)carbonyl)-1-(tert-butoxycarbonyl)piperazine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 138775-02-7 | Molecular Weight | 364.39300 | |
| Density | 1.272g/cm3 | Boiling Point | 518.9ºC at 760 mmHg | |
| Molecular Formula | C18H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.6ºC | |
| Name | (R)-4-((Benzyloxy)carbonyl)-1-(tert-butoxycarbonyl)piperazine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Boiling Point | 518.9ºC at 760 mmHg |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.39300 |
| Flash Point | 267.6ºC |
| Exact Mass | 364.16300 |
| PSA | 96.38000 |
| LogP | 2.20490 |
| Vapour Pressure | 1.36E-11mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | SREPAMKILVVDSP-CQSZACIVSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OCc2ccccc2)CC1C(=O)O |
| HS Code | 2933599090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2R)-1-[(2-methylpropan-2-yl)oxycarbonyl]-4-phenylmethoxycarbonylpiperazine-2-carboxylic acid |