Fmoc-DL-m-tyrosine structure
|
Common Name | Fmoc-DL-m-tyrosine | ||
|---|---|---|---|---|
| CAS Number | 138775-49-2 | Molecular Weight | 403.427 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 673.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 361.4±31.5 °C | |
| Name | Fmoc-DL-m-tyrosine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 673.9±55.0 °C at 760 mmHg |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.427 |
| Flash Point | 361.4±31.5 °C |
| Exact Mass | 403.141968 |
| PSA | 95.86000 |
| LogP | 4.67 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | QTAKQPPYEQCJTJ-UHFFFAOYSA-N |
| SMILES | O=C(NC(Cc1cccc(O)c1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Fmoc-3-hydroxy-DL-phenylalanine |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-hydroxyphenylalanine |
| Phenylalanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-3-hydroxy- |