4-bromo-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrazole-3-carboxamide structure
|
Common Name | 4-bromo-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrazole-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 138786-99-9 | Molecular Weight | 322.11300 | |
| Density | 2.28g/cm3 | Boiling Point | 636.4ºC at 760 mmHg | |
| Molecular Formula | C9H12BrN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 338.7ºC | |
| Name | 4-bromo-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrazole-3-carboxamide |
|---|
| Density | 2.28g/cm3 |
|---|---|
| Boiling Point | 636.4ºC at 760 mmHg |
| Molecular Formula | C9H12BrN3O5 |
| Molecular Weight | 322.11300 |
| Flash Point | 338.7ºC |
| Exact Mass | 320.99600 |
| PSA | 130.83000 |
| Vapour Pressure | 4.54E-17mmHg at 25°C |
| Index of Refraction | 1.798 |
| InChIKey | JYPFLOBSMUJIPQ-FJGDRVTGSA-N |
| SMILES | NC(=O)c1nn(C2OC(CO)C(O)C2O)cc1Br |
|
~77%
4-bromo-1-[(2R,... CAS#:138786-99-9 |
| Literature: Manfredini, Stefano; Bazzanini, Rita; Baraldi, Pier Giovanni; Guarneri, Mario; Simoni, Daniele; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 5 p. 917 - 924 |
|
~%
4-bromo-1-[(2R,... CAS#:138786-99-9 |
| Literature: Manfredini, Stefano; Bazzanini, Rita; Baraldi, Pier Giovanni; Guarneri, Mario; Simoni, Daniele; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 5 p. 917 - 924 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |