4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid
Modify Date: 2025-08-29 10:58:14
![4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/147/1388058-30-7.png)
4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid structure
|
Common Name | 4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1388058-30-7 | Molecular Weight | 192.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8N2O3 |
|---|---|
| Molecular Weight | 192.17 |
| InChIKey | ZSOLPDHMOIDVJA-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)O)ccc2[nH]c(=O)[nH]c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid? |
| A: SMILES notation of 4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid is Cc1c(C(=O)O)ccc2[nH]c(=O)[nH]c12. |
| Q: What is the English name of 4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid? |
| A: The English name of 4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid is 4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid. |
| Q: What is the CAS number of 4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid? |
| A: CAS number of 4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid is 1388058-30-7. |
| Q: What is the molecular weight of 4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid? |
| A: Molecular weight of 4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid is 192.17. |
| Q: What is the molecular formula of 4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid? |
| A: Molecular formula of 4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid is C9H8N2O3. |
| Q: What is the Chinese name of 1388058-30-7? |
| A: Chinese name of 1388058-30-7 is 1388058-30-7. |
| Q: What is the InChIKey of 4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid? |
| A: InChIKey of 4-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid is ZSOLPDHMOIDVJA-UHFFFAOYSA-N. |