6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole
Modify Date: 2026-09-29 18:12:56
6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole structure
|
Common Name | 6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole | ||
|---|---|---|---|---|
| CAS Number | 1388076-10-5 | Molecular Weight | 259.53 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8BrClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8BrClN2 |
|---|---|
| Molecular Weight | 259.53 |
| InChIKey | HDUHAGPFJUPXMZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)cc2[nH]c(CCl)nc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole? |
| A: Molecular weight of 6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole is 259.53. |
| Q: What is the CAS number of 6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole? |
| A: CAS number of 6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole is 1388076-10-5. |
| Q: What is the InChIKey of 6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole? |
| A: InChIKey of 6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole is HDUHAGPFJUPXMZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole? |
| A: Molecular formula of 6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole is C9H8BrClN2. |
| Q: What is the SMILES notation of 6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole? |
| A: SMILES notation of 6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole is Cc1cc(Br)cc2[nH]c(CCl)nc12. |
| Q: What is the English name of 6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole? |
| A: The English name of 6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole is 6-bromo-2-(chloromethyl)-4-methyl-1H-1,3-benzodiazole. |
| Q: What is the Chinese name of 1388076-10-5? |
| A: Chinese name of 1388076-10-5 is 1388076-10-5. |