(S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine
Modify Date: 2025-09-15 09:47:21
(S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine structure
|
Common Name | (S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 1388128-18-4 | Molecular Weight | 199.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15F2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15F2N |
|---|---|
| Molecular Weight | 199.24 |
| InChIKey | ZILWZLZJALGQBY-SNVBAGLBSA-N |
| SMILES | CC(C)(C)C(N)c1cc(F)cc(F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine? |
| A: Molecular weight of (S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine is 199.24. |
| Q: What is the molecular formula of (S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine? |
| A: Molecular formula of (S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine is C11H15F2N. |
| Q: What is the InChIKey of (S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine? |
| A: InChIKey of (S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine is ZILWZLZJALGQBY-SNVBAGLBSA-N. |
| Q: What is the SMILES notation of (S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine? |
| A: SMILES notation of (S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine is CC(C)(C)C(N)c1cc(F)cc(F)c1. |
| Q: What is the English name of (S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine? |
| A: The English name of (S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine is (S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine. |
| Q: What is the CAS number of (S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine? |
| A: CAS number of (S)-1-(3,5-Difluorophenyl)-2,2-dimethylpropan-1-amine is 1388128-18-4. |
| Q: What is the Chinese name of 1388128-18-4? |
| A: Chinese name of 1388128-18-4 is 1388128-18-4. |