5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid
Modify Date: 2025-09-15 16:24:11
5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid structure
|
Common Name | 5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 138815-61-9 | Molecular Weight | 286.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14N2O4 |
|---|---|
| Molecular Weight | 286.28 |
| InChIKey | IZHKINDOSPHFGJ-UHFFFAOYSA-N |
| SMILES | CCOc1ccccc1NC(=O)c1ccc(C(=O)O)nc1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of prolyl 4-hydroxylase activity by an indirect assay
Source: ChEMBL
Target: Transmembrane prolyl 4-hydroxylase
External Id: CHEMBL765593
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid? |
| A: Molecular weight of 5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid is 286.28. |
| Q: What is the molecular formula of 5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid? |
| A: Molecular formula of 5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid is C15H14N2O4. |
| Q: What is the SMILES notation of 5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid? |
| A: SMILES notation of 5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid is CCOc1ccccc1NC(=O)c1ccc(C(=O)O)nc1. |
| Q: What is the CAS number of 5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid? |
| A: CAS number of 5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid is 138815-61-9. |
| Q: What is the English name of 5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid? |
| A: The English name of 5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid is 5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid. |
| Q: What is the InChIKey of 5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid? |
| A: InChIKey of 5-(2-Ethoxy-phenylcarbamoyl)-pyridine-2-carboxylic acid is IZHKINDOSPHFGJ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 138815-61-9? |
| A: Chinese name of 138815-61-9 is 138815-61-9. |