Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride
Modify Date: 2026-07-02 22:28:22
Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride structure
|
Common Name | Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1389356-06-2 | Molecular Weight | 278.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13Cl2NO3 |
|---|---|
| Molecular Weight | 278.13 |
| InChIKey | DCHQPJJNLZWQDN-SBSPUUFOSA-N |
| SMILES | COC(=O)c1cc(Cl)c2c(c1)C(N)CCO2.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1389356-06-2? |
| A: Chinese name of 1389356-06-2 is 1389356-06-2. |
| Q: What is the InChIKey of Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride? |
| A: InChIKey of Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride is DCHQPJJNLZWQDN-SBSPUUFOSA-N. |
| Q: What is the CAS number of Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride? |
| A: CAS number of Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride is 1389356-06-2. |
| Q: What is the English name of Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride? |
| A: The English name of Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride is Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride. |
| Q: What is the SMILES notation of Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride? |
| A: SMILES notation of Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride is COC(=O)c1cc(Cl)c2c(c1)C(N)CCO2.Cl. |
| Q: What is the molecular weight of Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride? |
| A: Molecular weight of Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride is 278.13. |
| Q: What is the molecular formula of Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride? |
| A: Molecular formula of Methyl (R)-4-amino-8-chlorochromane-6-carboxylate hydrochloride is C11H13Cl2NO3. |